About oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate
oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate (PubChem CID 157383449) has the molecular formula C19H21NO10S2
and a molecular weight of 487.51 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate |
| PubChem CID | 157383449 |
| Molecular Formula | C19H21NO10S2 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CO2)cc1.O=[N+]([O-])c1cccc(S(=O)(=O)OCC2CO2)c1 |
| InChI | InChI=1S/C10H12O4S.C9H9NO6S/c1-8-2-4-10(5-3-8)15(11,12)14-7-9-6-13-9;11-10(12)7-2-1-3-9(4-7)17(13,14)16-6-8-5-15-8/h2-5,9H,6-7H2,1H3;1-4,8H,5-6H2 |
| InChIKey | BLDPXKNDVSEIDZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 154.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate?
The IUPAC name of oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate (CID 157383449) is oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate.
What is the SMILES notation for oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate?
The canonical SMILES for oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2CO2)cc1.O=[N+]([O-])c1cccc(S(=O)(=O)OCC2CO2)c1.
What is the InChIKey of oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate?
The InChIKey is BLDPXKNDVSEIDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4S.C9H9NO6S/c1-8-2-4-10(5-3-8)15(11,12)14-7-9-6-13-9;11-10(12)7-2-1-3-9(4-7)17(13,14)16-6-8-5-15-8/h2-5,9H,6-7H2,1H3;1-4,8H,5-6H2.
What are the key properties of oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate?
oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate has a molecular weight of 487.51 g/mol, XLogP of 1.80, 9 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate is sourced from PubChem (CID 157383449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).