C19H21NO10S2 — CID 157383449
oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate (PubChem CID 157383449) has the molecular formula C19H21NO10S2 and a molecular weight of 487.51 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate.
| Compound Name | oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 157383449 |
| Molecular Formula | C19H21NO10S2 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | oxiran-2-ylmethyl 4-methylbenzenesulfonate;oxiran-2-ylmethyl 3-nitrobenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CO2)cc1.O=[N+]([O-])c1cccc(S(=O)(=O)OCC2CO2)c1 |
| InChI | InChI=1S/C10H12O4S.C9H9NO6S/c1-8-2-4-10(5-3-8)15(11,12)14-7-9-6-13-9;11-10(12)7-2-1-3-9(4-7)17(13,14)16-6-8-5-15-8/h2-5,9H,6-7H2,1H3;1-4,8H,5-6H2 |
| InChIKey | BLDPXKNDVSEIDZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 154.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|