C16H22O7S — CID 159519507
2-(oxiran-2-ylmethoxymethyl)oxirane;oxiran-2-ylmethyl 4-methylbenzenesulfonate (PubChem CID 159519507) has the molecular formula C16H22O7S and a molecular weight of 358.41 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;oxiran-2-ylmethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;oxiran-2-ylmethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159519507 |
| Molecular Formula | C16H22O7S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;oxiran-2-ylmethyl 4-methylbenzenesulfonate |
| SMILES | C(OCC1CO1)C1CO1.Cc1ccc(S(=O)(=O)OCC2CO2)cc1 |
| InChI | InChI=1S/C10H12O4S.C6H10O3/c1-8-2-4-10(5-3-8)15(11,12)14-7-9-6-13-9;1(5-3-8-5)7-2-6-4-9-6/h2-5,9H,6-7H2,1H3;5-6H,1-4H2 |
| InChIKey | MBPZDOCXANCZCC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|