C14H22O5S3 — CID 157192430
[(2S,5S)-5-ethenyl-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate;sulfane (PubChem CID 157192430) has the molecular formula C14H22O5S3 and a molecular weight of 366.53 g/mol. Its IUPAC name is [(2S,5S)-5-ethenyl-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate;sulfane.
| Compound Name | [(2S,5S)-5-ethenyl-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate;sulfane |
|---|---|
| PubChem CID | 157192430 |
| Molecular Formula | C14H22O5S3 |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [(2S,5S)-5-ethenyl-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate;sulfane |
| SMILES | C=C[C@H]1CO[C@H](COS(=O)(=O)c2ccc(C)cc2)CO1.S.S |
| InChI | InChI=1S/C14H18O5S.2H2S/c1-3-12-8-18-13(9-17-12)10-19-20(15,16)14-6-4-11(2)5-7-14;;/h3-7,12-13H,1,8-10H2,2H3;2*1H2/t12-,13-;;/m0../s1 |
| InChIKey | APVXCELZSBJMCX-NJHZPMQHSA-N |
| XLogP | 1.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|