C13H16O6S — CID 143754382
[(2R)-5-formyl-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 143754382) has the molecular formula C13H16O6S and a molecular weight of 300.33 g/mol. Its IUPAC name is [(2R)-5-formyl-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R)-5-formyl-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 143754382 |
| Molecular Formula | C13H16O6S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [(2R)-5-formyl-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2COC(C=O)CO2)cc1 |
| InChI | InChI=1S/C13H16O6S/c1-10-2-4-13(5-3-10)20(15,16)19-9-12-8-17-11(6-14)7-18-12/h2-6,11-12H,7-9H2,1H3/t11?,12-/m1/s1 |
| InChIKey | QXPPRXLIVHTUSM-PIJUOVFKSA-N |
| XLogP | 0.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|