C22H26O10S2 — CID 100876370
[(3aS,4R,8S,8aS)-4-[(4-methylphenyl)sulfonyloxymethyl]-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepin-8-yl]methyl 4-methylbenzenesulfonate (PubChem CID 100876370) has the molecular formula C22H26O10S2 and a molecular weight of 514.57 g/mol. Its IUPAC name is [(3aS,4R,8S,8aS)-4-[(4-methylphenyl)sulfonyloxymethyl]-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepin-8-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aS,4R,8S,8aS)-4-[(4-methylphenyl)sulfonyloxymethyl]-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepin-8-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 100876370 |
| Molecular Formula | C22H26O10S2 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | [(3aS,4R,8S,8aS)-4-[(4-methylphenyl)sulfonyloxymethyl]-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]dioxepin-8-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2OCO[C@H](COS(=O)(=O)c3ccc(C)cc3)[C@@H]3OCO[C@H]32)cc1 |
| InChI | InChI=1S/C22H26O10S2/c1-15-3-7-17(8-4-15)33(23,24)31-11-19-21-22(30-14-29-21)20(28-13-27-19)12-32-34(25,26)18-9-5-16(2)6-10-18/h3-10,19-22H,11-14H2,1-2H3/t19-,20+,21-,22-/m0/s1 |
| InChIKey | YNZAAATWSNLIAG-LRSLUSHPSA-N |
| XLogP | 1.90 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|