C15H20O7S — CID 175678256
[(3R,4S,5R)-1,4,5-trihydroxy-6,6-dimethyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 175678256) has the molecular formula C15H20O7S and a molecular weight of 344.39 g/mol. Its IUPAC name is [(3R,4S,5R)-1,4,5-trihydroxy-6,6-dimethyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3R,4S,5R)-1,4,5-trihydroxy-6,6-dimethyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175678256 |
| Molecular Formula | C15H20O7S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [(3R,4S,5R)-1,4,5-trihydroxy-6,6-dimethyl-2-oxabicyclo[3.1.0]hexan-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC3(O)C(C)(C)[C@@]3(O)[C@H]2O)cc1 |
| InChI | InChI=1S/C15H20O7S/c1-9-4-6-10(7-5-9)23(19,20)21-8-11-12(16)14(17)13(2,3)15(14,18)22-11/h4-7,11-12,16-18H,8H2,1-3H3/t11-,12+,14+,15?/m1/s1 |
| InChIKey | NMEJEQRNYITCRP-JNZNFYPTSA-N |
| XLogP | -0.08 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|