C34H36O14S4 — CID 171124669
[(2R,3R,4S,5R,6R)-6-hydroxy-3,4,5-tris-(4-methylphenyl)sulfonyloxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 171124669) has the molecular formula C34H36O14S4 and a molecular weight of 796.92 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-hydroxy-3,4,5-tris-(4-methylphenyl)sulfonyloxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-hydroxy-3,4,5-tris-(4-methylphenyl)sulfonyloxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171124669 |
| Molecular Formula | C34H36O14S4 |
| Molecular Weight | 796.92 g/mol |
| Exact Mass | 796.10 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-hydroxy-3,4,5-tris-(4-methylphenyl)sulfonyloxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H](O)[C@H](OS(=O)(=O)c3ccc(C)cc3)[C@@H](OS(=O)(=O)c3ccc(C)cc3)[C@@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H36O14S4/c1-22-5-13-26(14-6-22)49(36,37)44-21-30-31(46-50(38,39)27-15-7-23(2)8-16-27)32(47-51(40,41)28-17-9-24(3)10-18-28)33(34(35)45-30)48-52(42,43)29-19-11-25(4)12-20-29/h5-20,30-35H,21H2,1-4H3/t30-,31-,32+,33-,34-/m1/s1 |
| InChIKey | XOBKAEKZFBPVSH-BGSSSCFASA-N |
| XLogP | 3.67 |
| TPSA | 202.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|