C26H26O10S2 — CID 171126549
[(2R,3S,4S,5S)-2-hydroxy-4-(4-methylphenyl)sulfonyloxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] benzoate (PubChem CID 171126549) has the molecular formula C26H26O10S2 and a molecular weight of 562.62 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-2-hydroxy-4-(4-methylphenyl)sulfonyloxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S,5S)-2-hydroxy-4-(4-methylphenyl)sulfonyloxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 171126549 |
| Molecular Formula | C26H26O10S2 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | [(2R,3S,4S,5S)-2-hydroxy-4-(4-methylphenyl)sulfonyloxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2O[C@@H](O)[C@@H](OC(=O)c3ccccc3)[C@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H26O10S2/c1-17-8-12-20(13-9-17)37(29,30)33-16-22-23(36-38(31,32)21-14-10-18(2)11-15-21)24(26(28)34-22)35-25(27)19-6-4-3-5-7-19/h3-15,22-24,26,28H,16H2,1-2H3/t22-,23-,24-,26+/m0/s1 |
| InChIKey | SXHMMMYMCCJXDU-JAYJDBRPSA-N |
| XLogP | 2.73 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|