C22H24O8S — CID 66553997
[(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate (PubChem CID 66553997) has the molecular formula C22H24O8S and a molecular weight of 448.49 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate.
| Compound Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate |
|---|---|
| PubChem CID | 66553997 |
| Molecular Formula | C22H24O8S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24O8S/c1-14-9-11-16(12-10-14)31(24,25)26-13-17-18(19-21(27-17)30-22(2,3)29-19)28-20(23)15-7-5-4-6-8-15/h4-12,17-19,21H,13H2,1-3H3/t17-,18+,19-,21-/m1/s1 |
| InChIKey | PSMLHJBSLGLXKA-RCLSDMTESA-N |
| XLogP | 2.80 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|