C34H32O12S2 — CID 171126996
[(2R,3S,4S,5S,6R)-4-benzoyloxy-6-hydroxy-5-(4-methylphenyl)sulfonyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate (PubChem CID 171126996) has the molecular formula C34H32O12S2 and a molecular weight of 696.75 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-4-benzoyloxy-6-hydroxy-5-(4-methylphenyl)sulfonyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S,5S,6R)-4-benzoyloxy-6-hydroxy-5-(4-methylphenyl)sulfonyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 171126996 |
| Molecular Formula | C34H32O12S2 |
| Molecular Weight | 696.75 g/mol |
| Exact Mass | 696.13 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-4-benzoyloxy-6-hydroxy-5-(4-methylphenyl)sulfonyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H](O)[C@@H](OS(=O)(=O)c3ccc(C)cc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H32O12S2/c1-22-13-17-26(18-14-22)47(38,39)42-21-28-29(44-32(35)24-9-5-3-6-10-24)30(45-33(36)25-11-7-4-8-12-25)31(34(37)43-28)46-48(40,41)27-19-15-23(2)16-20-27/h3-20,28-31,34,37H,21H2,1-2H3/t28-,29+,30+,31+,34-/m1/s1 |
| InChIKey | JEZZUVYSPJCPST-HWFFBAQVSA-N |
| XLogP | 3.95 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|