C16H24O8S — CID 171126193
[(2R,3R,4S,5S,6S)-6-hydroxy-3,4,5-trimethoxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 171126193) has the molecular formula C16H24O8S and a molecular weight of 376.43 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-6-hydroxy-3,4,5-trimethoxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S,5S,6S)-6-hydroxy-3,4,5-trimethoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171126193 |
| Molecular Formula | C16H24O8S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-6-hydroxy-3,4,5-trimethoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1[C@H](OC)[C@@H](O)O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@H]1OC |
| InChI | InChI=1S/C16H24O8S/c1-10-5-7-11(8-6-10)25(18,19)23-9-12-13(20-2)14(21-3)15(22-4)16(17)24-12/h5-8,12-17H,9H2,1-4H3/t12-,13-,14+,15+,16+/m1/s1 |
| InChIKey | XIFDATQWJMDYKA-OWYFMNJBSA-N |
| XLogP | 0.46 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|