C24H28O11S2 — CID 11082242
[(2R,3R,4R,5R)-4-acetyloxy-2,5-bis[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate (PubChem CID 11082242) has the molecular formula C24H28O11S2 and a molecular weight of 556.61 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-2,5-bis[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-2,5-bis[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11082242 |
| Molecular Formula | C24H28O11S2 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-2,5-bis[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](COS(=O)(=O)c2ccc(C)cc2)O[C@@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28O11S2/c1-15-5-9-19(10-6-15)36(27,28)31-13-21-23(33-17(3)25)24(34-18(4)26)22(35-21)14-32-37(29,30)20-11-7-16(2)8-12-20/h5-12,21-24H,13-14H2,1-4H3/t21-,22-,23-,24-/m1/s1 |
| InChIKey | JMLOGXBWIKNCOJ-MOUTVQLLSA-N |
| XLogP | 2.05 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|