C19H23BrO8S — CID 45257778
[(2R,3R,4R,5S,6R)-4,5-diacetyl-6-bromo-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (PubChem CID 45257778) has the molecular formula C19H23BrO8S and a molecular weight of 491.36 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-4,5-diacetyl-6-bromo-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-4,5-diacetyl-6-bromo-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 45257778 |
| Molecular Formula | C19H23BrO8S |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-4,5-diacetyl-6-bromo-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C(C)=O)[C@@H](C(C)=O)[C@@H](Br)O[C@@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23BrO8S/c1-10-5-7-14(8-6-10)29(24,25)26-9-15-18(27-13(4)23)16(11(2)21)17(12(3)22)19(20)28-15/h5-8,15-19H,9H2,1-4H3/t15-,16-,17-,18+,19+/m1/s1 |
| InChIKey | LZPQHSGGLMTETI-QQXKLLMISA-N |
| XLogP | 2.16 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|