C21H27N3O11S — CID 118692377
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(2-azidoethoxy)-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (PubChem CID 118692377) has the molecular formula C21H27N3O11S and a molecular weight of 529.52 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(2-azidoethoxy)-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(2-azidoethoxy)-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 118692377 |
| Molecular Formula | C21H27N3O11S |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(2-azidoethoxy)-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OCCN=[N+]=[N-])O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H27N3O11S/c1-12-5-7-16(8-6-12)36(28,29)31-11-17-18(32-13(2)25)19(33-14(3)26)20(34-15(4)27)21(35-17)30-10-9-23-24-22/h5-8,17-21H,9-11H2,1-4H3/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | SZYPHMLUJHBWDE-YMQHIKHWSA-N |
| XLogP | 1.55 |
| TPSA | 189.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|