C31H32N4O10S — CID 162407749
[(2R,3S,4R,5R,6S)-5-acetamido-6-(2-azidoethoxy)-4-benzoyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate (PubChem CID 162407749) has the molecular formula C31H32N4O10S and a molecular weight of 652.68 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-6-(2-azidoethoxy)-4-benzoyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-6-(2-azidoethoxy)-4-benzoyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 162407749 |
| Molecular Formula | C31H32N4O10S |
| Molecular Weight | 652.68 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-6-(2-azidoethoxy)-4-benzoyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] benzoate |
| SMILES | CC(=O)N[C@H]1[C@@H](OCCN=[N+]=[N-])O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H32N4O10S/c1-20-13-15-24(16-14-20)46(39,40)42-19-25-27(44-29(37)22-9-5-3-6-10-22)28(45-30(38)23-11-7-4-8-12-23)26(34-21(2)36)31(43-25)41-18-17-33-35-32/h3-16,25-28,31H,17-19H2,1-2H3,(H,34,36)/t25-,26-,27-,28-,31+/m1/s1 |
| InChIKey | HVOOBVURYPCFHN-QWCZOQLWSA-N |
| XLogP | 3.71 |
| TPSA | 192.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|