C44H45N3O13 — CID 134575086
[(2R,3R,4S,5S,6S)-2-[[(2R,3R,4S,5R,6R)-6-(2-azidoethoxy)-3,4,5-tribenzoyloxyoxan-2-yl]methoxy]-6-(hydroxymethyl)-4,5-dimethyloxan-3-yl] benzoate (PubChem CID 134575086) has the molecular formula C44H45N3O13 and a molecular weight of 823.85 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2-[[(2R,3R,4S,5R,6R)-6-(2-azidoethoxy)-3,4,5-tribenzoyloxyoxan-2-yl]methoxy]-6-(hydroxymethyl)-4,5-dimethyloxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-2-[[(2R,3R,4S,5R,6R)-6-(2-azidoethoxy)-3,4,5-tribenzoyloxyoxan-2-yl]methoxy]-6-(hydroxymethyl)-4,5-dimethyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 134575086 |
| Molecular Formula | C44H45N3O13 |
| Molecular Weight | 823.85 g/mol |
| Exact Mass | 823.30 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2-[[(2R,3R,4S,5R,6R)-6-(2-azidoethoxy)-3,4,5-tribenzoyloxyoxan-2-yl]methoxy]-6-(hydroxymethyl)-4,5-dimethyloxan-3-yl] benzoate |
| SMILES | C[C@H]1[C@H](C)[C@@H](CO)O[C@@H](OC[C@H]2O[C@@H](OCCN=[N+]=[N-])[C@H](OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@@H]2OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C44H45N3O13/c1-27-28(2)35(57-39(49)29-15-7-3-8-16-29)43(55-33(27)25-48)54-26-34-36(58-40(50)30-17-9-4-10-18-30)37(59-41(51)31-19-11-5-12-20-31)38(44(56-34)53-24-23-46-47-45)60-42(52)32-21-13-6-14-22-32/h3-22,27-28,33-38,43-44,48H,23-26H2,1-2H3/t27-,28-,33+,34+,35+,36+,37-,38+,43+,44+/m0/s1 |
| InChIKey | JTFQTFZZFUWBEG-SVFHJOGRSA-N |
| XLogP | 5.95 |
| TPSA | 211.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.85 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|