C33H34O9 — CID 11692701
[(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-6-[(Z)-hex-3-enoxy]-2-(hydroxymethyl)oxan-3-yl] benzoate (PubChem CID 11692701) has the molecular formula C33H34O9 and a molecular weight of 574.63 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-6-[(Z)-hex-3-enoxy]-2-(hydroxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-6-[(Z)-hex-3-enoxy]-2-(hydroxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11692701 |
| Molecular Formula | C33H34O9 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-6-[(Z)-hex-3-enoxy]-2-(hydroxymethyl)oxan-3-yl] benzoate |
| SMILES | CC/C=C\CCO[C@@H]1O[C@H](CO)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H34O9/c1-2-3-4-14-21-38-33-29(42-32(37)25-19-12-7-13-20-25)28(41-31(36)24-17-10-6-11-18-24)27(26(22-34)39-33)40-30(35)23-15-8-5-9-16-23/h3-13,15-20,26-29,33-34H,2,14,21-22H2,1H3/b4-3-/t26-,27-,28+,29-,33-/m1/s1 |
| InChIKey | MLFPYRAKXFZZEI-VTOWWQMZSA-N |
| XLogP | 4.75 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|