C34H30O9 — CID 5063703
[4,6-dibenzoyloxy-2-(hydroxymethyl)-5-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 5063703) has the molecular formula C34H30O9 and a molecular weight of 582.61 g/mol. Its IUPAC name is [4,6-dibenzoyloxy-2-(hydroxymethyl)-5-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [4,6-dibenzoyloxy-2-(hydroxymethyl)-5-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 5063703 |
| Molecular Formula | C34H30O9 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | [4,6-dibenzoyloxy-2-(hydroxymethyl)-5-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | O=C(OC1OC(CO)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H30O9/c35-21-27-28(41-31(36)24-15-7-2-8-16-24)29(42-32(37)25-17-9-3-10-18-25)30(39-22-23-13-5-1-6-14-23)34(40-27)43-33(38)26-19-11-4-12-20-26/h1-20,27-30,34-35H,21-22H2 |
| InChIKey | BLQLZMGYRSAQDS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|