C41H34O10 — CID 11490912
[(2S,3R,4S,5R,6R)-3,5,6-tribenzoyloxy-4-phenylmethoxyoxan-2-yl]methyl benzoate (PubChem CID 11490912) has the molecular formula C41H34O10 and a molecular weight of 686.71 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3,5,6-tribenzoyloxy-4-phenylmethoxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-3,5,6-tribenzoyloxy-4-phenylmethoxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11490912 |
| Molecular Formula | C41H34O10 |
| Molecular Weight | 686.71 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,5,6-tribenzoyloxy-4-phenylmethoxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1O[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H34O10/c42-37(29-18-8-2-9-19-29)47-27-33-34(49-38(43)30-20-10-3-11-21-30)35(46-26-28-16-6-1-7-17-28)36(50-39(44)31-22-12-4-13-23-31)41(48-33)51-40(45)32-24-14-5-15-25-32/h1-25,33-36,41H,26-27H2/t33-,34+,35-,36+,41+/m0/s1 |
| InChIKey | GALCYWIRRKZYFE-RMNOJEGLSA-N |
| XLogP | 6.46 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|