C66H52O18 — CID 11979358
(3,4,5-tribenzoyloxyoxolan-2-yl)methyl benzoate (PubChem CID 11979358) has the molecular formula C66H52O18 and a molecular weight of 1133.12 g/mol. Its IUPAC name is (3,4,5-tribenzoyloxyoxolan-2-yl)methyl benzoate.
| Compound Name | (3,4,5-tribenzoyloxyoxolan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 11979358 |
| Molecular Formula | C66H52O18 |
| Molecular Weight | 1133.12 g/mol |
| Exact Mass | 1132.32 |
| IUPAC Name | (3,4,5-tribenzoyloxyoxolan-2-yl)methyl benzoate |
| SMILES | O=C(OCC1OC(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1.O=C(OCC1OC(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C33H26O9/c2*34-29(22-13-5-1-6-14-22)38-21-26-27(40-30(35)23-15-7-2-8-16-23)28(41-31(36)24-17-9-3-10-18-24)33(39-26)42-32(37)25-19-11-4-12-20-25/h2*1-20,26-28,33H,21H2 |
| InChIKey | PJHGFKHHTSCENB-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 228.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1133.12 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|