C36H30Cl3NO9 — CID 122396033
[(2R,3R,4S,5R,6R)-3,5-dibenzoyloxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate (PubChem CID 122396033) has the molecular formula C36H30Cl3NO9 and a molecular weight of 726.99 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-dibenzoyloxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-dibenzoyloxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 122396033 |
| Molecular Formula | C36H30Cl3NO9 |
| Molecular Weight | 726.99 g/mol |
| Exact Mass | 725.10 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-dibenzoyloxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C36H30Cl3NO9/c37-36(38,39)35(40)49-34-30(48-33(43)26-19-11-4-12-20-26)29(44-21-23-13-5-1-6-14-23)28(47-32(42)25-17-9-3-10-18-25)27(46-34)22-45-31(41)24-15-7-2-8-16-24/h1-20,27-30,34,40H,21-22H2/b40-35+/t27-,28-,29+,30-,34-/m1/s1 |
| InChIKey | ACXNJAYAZVTNFJ-OWOOGUBDSA-N |
| XLogP | 6.97 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.99 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|