C32H36Cl3NO10 — CID 71712954
[(2R,3R,4S,5S,6R)-5-(4-oxopentanoyloxy)-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 4-oxopentanoate (PubChem CID 71712954) has the molecular formula C32H36Cl3NO10 and a molecular weight of 701.00 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-5-(4-oxopentanoyloxy)-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 4-oxopentanoate.
| Compound Name | [(2R,3R,4S,5S,6R)-5-(4-oxopentanoyloxy)-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 4-oxopentanoate |
|---|---|
| PubChem CID | 71712954 |
| Molecular Formula | C32H36Cl3NO10 |
| Molecular Weight | 701.00 g/mol |
| Exact Mass | 699.14 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-5-(4-oxopentanoyloxy)-3,4-bis(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl 4-oxopentanoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(=O)CCC(C)=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OC(=O)CCC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C32H36Cl3NO10/c1-20(37)13-15-25(39)41-19-24-27(42-17-22-9-5-3-6-10-22)28(43-18-23-11-7-4-8-12-23)29(45-26(40)16-14-21(2)38)30(44-24)46-31(36)32(33,34)35/h3-12,24,27-30,36H,13-19H2,1-2H3/b36-31+/t24-,27-,28+,29+,30-/m1/s1 |
| InChIKey | GLHUBBVURNBRKB-FMOKYNJRSA-N |
| XLogP | 5.44 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.00 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|