C34H36Cl3NO8 — CID 101364535
[(2S,3R,4S,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate (PubChem CID 101364535) has the molecular formula C34H36Cl3NO8 and a molecular weight of 693.02 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 101364535 |
| Molecular Formula | C34H36Cl3NO8 |
| Molecular Weight | 693.02 g/mol |
| Exact Mass | 691.15 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)CCC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C34H36Cl3NO8/c1-23(39)17-18-28(40)45-31-30(43-21-26-15-9-4-10-16-26)29(42-20-25-13-7-3-8-14-25)27(22-41-19-24-11-5-2-6-12-24)44-32(31)46-33(38)34(35,36)37/h2-16,27,29-32,38H,17-22H2,1H3/b38-33+/t27-,29+,30+,31-,32+/m1/s1 |
| InChIKey | KFWPQVRNNBOJKJ-YLWSAWOHSA-N |
| XLogP | 6.74 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.02 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|