C30H40Cl3NO7Si — CID 100950354
[(3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 100950354) has the molecular formula C30H40Cl3NO7Si and a molecular weight of 661.10 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 100950354 |
| Molecular Formula | C30H40Cl3NO7Si |
| Molecular Weight | 661.10 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | [(3R,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/OC1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H40Cl3NO7Si/c1-20(35)39-26-25(37-18-22-15-11-8-12-16-22)24(36-17-21-13-9-7-10-14-21)23(19-38-42(5,6)29(2,3)4)40-27(26)41-28(34)30(31,32)33/h7-16,23-27,34H,17-19H2,1-6H3/b34-28+/t23-,24-,25+,26-,27?/m1/s1 |
| InChIKey | ZKHMYCZALXUSGA-AYDPFXMISA-N |
| XLogP | 7.20 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.10 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|