C30H32Cl3NO5 — CID 91207981
[6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 91207981) has the molecular formula C30H32Cl3NO5 and a molecular weight of 592.95 g/mol. Its IUPAC name is [6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 91207981 |
| Molecular Formula | C30H32Cl3NO5 |
| Molecular Weight | 592.95 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | [6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1OC(CC)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H32Cl3NO5/c1-2-24-25(35-18-21-12-6-3-7-13-21)26(36-19-22-14-8-4-9-15-22)27(37-20-23-16-10-5-11-17-23)28(38-24)39-29(34)30(31,32)33/h3-17,24-28,34H,2,18-20H2,1H3/b34-29+ |
| InChIKey | OCAAWOLCAYPUIP-RIHQVDFKSA-N |
| XLogP | 7.24 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.95 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|