C30H30Cl3NO7 — CID 129274139
methyl 3,4,5-tris(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate (PubChem CID 129274139) has the molecular formula C30H30Cl3NO7 and a molecular weight of 622.93 g/mol. Its IUPAC name is methyl 3,4,5-tris(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate.
| Compound Name | methyl 3,4,5-tris(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 129274139 |
| Molecular Formula | C30H30Cl3NO7 |
| Molecular Weight | 622.93 g/mol |
| Exact Mass | 621.11 |
| IUPAC Name | methyl 3,4,5-tris(phenylmethoxy)-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
| SMILES | [H]/N=C(/OC1OC(C(=O)OC)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H30Cl3NO7/c1-36-27(35)25-23(37-17-20-11-5-2-6-12-20)24(38-18-21-13-7-3-8-14-21)26(39-19-22-15-9-4-10-16-22)28(40-25)41-29(34)30(31,32)33/h2-16,23-26,28,34H,17-19H2,1H3/b34-29+ |
| InChIKey | RFSNPNMOXWTTNC-RIHQVDFKSA-N |
| XLogP | 6.00 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.93 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|