C26H26Cl3NO8 — CID 11296236
methyl (2R,3S,4S,5R,6S)-5-benzoyloxy-4-phenylmethoxy-3-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate (PubChem CID 11296236) has the molecular formula C26H26Cl3NO8 and a molecular weight of 586.85 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R,6S)-5-benzoyloxy-4-phenylmethoxy-3-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5R,6S)-5-benzoyloxy-4-phenylmethoxy-3-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 11296236 |
| Molecular Formula | C26H26Cl3NO8 |
| Molecular Weight | 586.85 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | methyl (2R,3S,4S,5R,6S)-5-benzoyloxy-4-phenylmethoxy-3-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H](C(=O)OC)[C@@H](OCC=C)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H26Cl3NO8/c1-3-14-34-18-19(35-15-16-10-6-4-7-11-16)21(36-22(31)17-12-8-5-9-13-17)24(37-20(18)23(32)33-2)38-25(30)26(27,28)29/h3-13,18-21,24,30H,1,14-15H2,2H3/b30-25+/t18-,19-,20+,21+,24-/m0/s1 |
| InChIKey | FUVPCCKSTLEXNJ-LIMININTSA-N |
| XLogP | 4.63 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|