C44H46Cl3NO11 — CID 134972498
[(2S,5S)-5-acetyloxy-6-methyl-4-[(2S,5S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate (PubChem CID 134972498) has the molecular formula C44H46Cl3NO11 and a molecular weight of 871.21 g/mol. Its IUPAC name is [(2S,5S)-5-acetyloxy-6-methyl-4-[(2S,5S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate.
| Compound Name | [(2S,5S)-5-acetyloxy-6-methyl-4-[(2S,5S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 134972498 |
| Molecular Formula | C44H46Cl3NO11 |
| Molecular Weight | 871.21 g/mol |
| Exact Mass | 869.21 |
| IUPAC Name | [(2S,5S)-5-acetyloxy-6-methyl-4-[(2S,5S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
| SMILES | [H]/N=C(/O[C@@H]1OC(C)[C@H](OC(C)=O)C(O[C@@H]2OC(C)[C@H](OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)C1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C44H46Cl3NO11/c1-27-34(51-24-30-16-8-4-9-17-30)36(52-25-31-18-10-5-11-19-31)38(53-26-32-20-12-6-13-21-32)41(54-27)58-37-35(56-29(3)49)28(2)55-42(59-43(48)44(45,46)47)39(37)57-40(50)33-22-14-7-15-23-33/h4-23,27-28,34-39,41-42,48H,24-26H2,1-3H3/b48-43+/t27?,28?,34-,35-,36?,37?,38?,39?,41-,42-/m0/s1 |
| InChIKey | BOUIMHYUILUXLK-HQLGZHGUSA-N |
| XLogP | 8.14 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.21 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|