C23H22Cl3NO7 — CID 102344171
[(2S,3S,4R,5R,6S)-5-benzoyloxy-4-methoxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate (PubChem CID 102344171) has the molecular formula C23H22Cl3NO7 and a molecular weight of 530.79 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-5-benzoyloxy-4-methoxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5R,6S)-5-benzoyloxy-4-methoxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 102344171 |
| Molecular Formula | C23H22Cl3NO7 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-5-benzoyloxy-4-methoxy-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2ccccc2)[C@@H](OC)[C@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H22Cl3NO7/c1-13-16(32-19(28)14-9-5-3-6-10-14)17(30-2)18(21(31-13)34-22(27)23(24,25)26)33-20(29)15-11-7-4-8-12-15/h3-13,16-18,21,27H,1-2H3/b27-22+/t13-,16-,17+,18+,21-/m0/s1 |
| InChIKey | HOJVQFYNEGKYBL-FLIXYKEBSA-N |
| XLogP | 4.56 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|