C18H22Cl3NO6 — CID 11113204
[(3R,4R,5S,6S)-4-methoxy-6-methyl-5-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 11113204) has the molecular formula C18H22Cl3NO6 and a molecular weight of 454.73 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-4-methoxy-6-methyl-5-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(3R,4R,5S,6S)-4-methoxy-6-methyl-5-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11113204 |
| Molecular Formula | C18H22Cl3NO6 |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | [(3R,4R,5S,6S)-4-methoxy-6-methyl-5-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/OC1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OC)[C@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H22Cl3NO6/c1-10-13(25-9-12-7-5-4-6-8-12)14(24-3)15(27-11(2)23)16(26-10)28-17(22)18(19,20)21/h4-8,10,13-16,22H,9H2,1-3H3/b22-17+/t10-,13-,14+,15+,16?/m0/s1 |
| InChIKey | WTMRAUCIFBOSMB-NEQXBEQZSA-N |
| XLogP | 3.63 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|