C27H30Cl3NO7 — CID 25157486
[(2S,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate (PubChem CID 25157486) has the molecular formula C27H30Cl3NO7 and a molecular weight of 586.90 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2S,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 25157486 |
| Molecular Formula | C27H30Cl3NO7 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-oxopentanoate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OC(=O)CCC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C27H30Cl3NO7/c1-17(32)13-14-21(33)37-24-23(35-16-20-11-7-4-8-12-20)22(34-15-19-9-5-3-6-10-19)18(2)36-25(24)38-26(31)27(28,29)30/h3-12,18,22-25,31H,13-16H2,1-2H3/b31-26+/t18-,22-,23+,24+,25-/m0/s1 |
| InChIKey | ANYWSDUYNNDAKV-FFKFFFQZSA-N |
| XLogP | 5.55 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|