C28H34O7 — CID 25157484
[(2R,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-prop-2-enoxyoxan-3-yl] 4-oxopentanoate (PubChem CID 25157484) has the molecular formula C28H34O7 and a molecular weight of 482.57 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-prop-2-enoxyoxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2R,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-prop-2-enoxyoxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 25157484 |
| Molecular Formula | C28H34O7 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-6-methyl-4,5-bis(phenylmethoxy)-2-prop-2-enoxyoxan-3-yl] 4-oxopentanoate |
| SMILES | C=CCO[C@@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OC(=O)CCC(C)=O |
| InChI | InChI=1S/C28H34O7/c1-4-17-31-28-27(35-24(30)16-15-20(2)29)26(33-19-23-13-9-6-10-14-23)25(21(3)34-28)32-18-22-11-7-5-8-12-22/h4-14,21,25-28H,1,15-19H2,2-3H3/t21-,25-,26+,27+,28+/m0/s1 |
| InChIKey | PQJRMYYEHQZAGH-ABDYMBPTSA-N |
| XLogP | 4.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|