C30H32O7 — CID 14393012
(2S,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxane-2-carboxylic acid (PubChem CID 14393012) has the molecular formula C30H32O7 and a molecular weight of 504.58 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 14393012 |
| Molecular Formula | C30H32O7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxane-2-carboxylic acid |
| SMILES | C=CCO[C@H]1O[C@H](C(=O)O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H32O7/c1-2-18-33-30-28(36-21-24-16-10-5-11-17-24)26(35-20-23-14-8-4-9-15-23)25(27(37-30)29(31)32)34-19-22-12-6-3-7-13-22/h2-17,25-28,30H,1,18-21H2,(H,31,32)/t25-,26-,27-,28+,30-/m0/s1 |
| InChIKey | KEYKGQFUXDUOGY-UFEOFEBPSA-N |
| XLogP | 4.75 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|