C35H36O6 — CID 68987679
1-[(2S,3S,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]ethanone (PubChem CID 68987679) has the molecular formula C35H36O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]ethanone.
| Compound Name | 1-[(2S,3S,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 68987679 |
| Molecular Formula | C35H36O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 1-[(2S,3S,4S,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1O[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H36O6/c1-26(36)31-32(37-22-27-14-6-2-7-15-27)33(38-23-28-16-8-3-9-17-28)34(39-24-29-18-10-4-11-19-29)35(41-31)40-25-30-20-12-5-13-21-30/h2-21,31-35H,22-25H2,1H3/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | SDSKAVFYKVPTLR-CKQPALCZSA-N |
| XLogP | 6.27 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |