C25H26O5 — CID 97267896
(2S,3S,4R,5S)-3,4,5-tris(phenylmethoxy)oxolan-2-ol (PubChem CID 97267896) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is (2S,3S,4R,5S)-3,4,5-tris(phenylmethoxy)oxolan-2-ol.
| Compound Name | (2S,3S,4R,5S)-3,4,5-tris(phenylmethoxy)oxolan-2-ol |
|---|---|
| PubChem CID | 97267896 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (2S,3S,4R,5S)-3,4,5-tris(phenylmethoxy)oxolan-2-ol |
| SMILES | O[C@H]1O[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H26O5/c26-24-22(27-16-19-10-4-1-5-11-19)23(28-17-20-12-6-2-7-13-20)25(30-24)29-18-21-14-8-3-9-15-21/h1-15,22-26H,16-18H2/t22-,23+,24-,25-/m0/s1 |
| InChIKey | HHJKMDPQFZBQOK-NDBXHCKUSA-N |
| XLogP | 4.05 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |