C47H52O11 — CID 91602456
(3R,4S,5R,6R)-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-3,4-bis(phenylmethoxy)oxan-2-ol (PubChem CID 91602456) has the molecular formula C47H52O11 and a molecular weight of 792.92 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-3,4-bis(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-3,4-bis(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 91602456 |
| Molecular Formula | C47H52O11 |
| Molecular Weight | 792.92 g/mol |
| Exact Mass | 792.35 |
| IUPAC Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-3,4-bis(phenylmethoxy)oxan-2-ol |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)C(O)O[C@@H]2CO)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C47H52O11/c48-26-38-40(51-28-33-16-6-1-7-17-33)42(52-29-34-18-8-2-9-19-34)45(55-32-37-24-14-5-15-25-37)47(57-38)58-41-39(27-49)56-46(50)44(54-31-36-22-12-4-13-23-36)43(41)53-30-35-20-10-3-11-21-35/h1-25,38-50H,26-32H2/t38-,39-,40-,41-,42+,43+,44-,45-,46?,47+/m1/s1 |
| InChIKey | SWVDGAWQQDCFEO-XKTQIJNXSA-N |
| XLogP | 5.73 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.92 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |