C42H50O9 — CID 70905902
[(3R,4S,6R)-6-[(2R,5S)-6-(hydroxymethyl)-3-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-3-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 70905902) has the molecular formula C42H50O9 and a molecular weight of 698.85 g/mol. Its IUPAC name is [(3R,4S,6R)-6-[(2R,5S)-6-(hydroxymethyl)-3-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-3-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(3R,4S,6R)-6-[(2R,5S)-6-(hydroxymethyl)-3-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-3-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 70905902 |
| Molecular Formula | C42H50O9 |
| Molecular Weight | 698.85 g/mol |
| Exact Mass | 698.35 |
| IUPAC Name | [(3R,4S,6R)-6-[(2R,5S)-6-(hydroxymethyl)-3-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-3-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CC1C(OCc2ccccc2)[C@H](OCc2ccccc2)C(CO)O[C@@H]1O[C@H]1OC(CO)[C@@H](C)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C42H50O9/c1-29-35(23-43)49-42(40(48-28-34-21-13-6-14-22-34)37(29)45-25-31-15-7-3-8-16-31)51-41-30(2)38(46-26-32-17-9-4-10-18-32)39(36(24-44)50-41)47-27-33-19-11-5-12-20-33/h3-22,29-30,35-44H,23-28H2,1-2H3/t29-,30?,35?,36?,37+,38?,39-,40?,41-,42-/m1/s1 |
| InChIKey | LXBDVTSHIVQVRG-XQPGTEBHSA-N |
| XLogP | 6.05 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |