C27H30O4 — CID 90128354
[(2S,4S,6S)-3-methyl-6-phenyl-4,5-bis(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 90128354) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(2S,4S,6S)-3-methyl-6-phenyl-4,5-bis(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2S,4S,6S)-3-methyl-6-phenyl-4,5-bis(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 90128354 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [(2S,4S,6S)-3-methyl-6-phenyl-4,5-bis(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CC1[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H](c2ccccc2)O[C@@H]1CO |
| InChI | InChI=1S/C27H30O4/c1-20-24(17-28)31-26(23-15-9-4-10-16-23)27(30-19-22-13-7-3-8-14-22)25(20)29-18-21-11-5-2-6-12-21/h2-16,20,24-28H,17-19H2,1H3/t20?,24-,25+,26+,27?/m1/s1 |
| InChIKey | AFTBWGNZHRSPMF-MTAUNMHSSA-N |
| XLogP | 4.93 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |