C40H40O5 — CID 11422041
(2S,3S,4R,5R,6R)-2-phenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 11422041) has the molecular formula C40H40O5 and a molecular weight of 600.76 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-phenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4R,5R,6R)-2-phenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 11422041 |
| Molecular Formula | C40H40O5 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-phenyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | c1ccc(COC[C@H]2O[C@@H](c3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C40H40O5/c1-6-16-31(17-7-1)26-41-30-36-38(42-27-32-18-8-2-9-19-32)40(44-29-34-22-12-4-13-23-34)39(43-28-33-20-10-3-11-21-33)37(45-36)35-24-14-5-15-25-35/h1-25,36-40H,26-30H2/t36-,37+,38-,39+,40+/m1/s1 |
| InChIKey | DICBLRVEAXYKQL-CSISHVCHSA-N |
| XLogP | 8.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |