C41H42O6 — CID 66864680
(2S,3S,4S,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 66864680) has the molecular formula C41H42O6 and a molecular weight of 630.78 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4S,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 66864680 |
| Molecular Formula | C41H42O6 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | c1ccc(COC[C@H]2O[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C41H42O6/c1-6-16-32(17-7-1)26-42-31-37-38(43-27-33-18-8-2-9-19-33)39(44-28-34-20-10-3-11-21-34)40(45-29-35-22-12-4-13-23-35)41(47-37)46-30-36-24-14-5-15-25-36/h1-25,37-41H,26-31H2/t37-,38-,39+,40+,41+/m1/s1 |
| InChIKey | DGGSYWYWUWWYJA-HJRBIJKLSA-N |
| XLogP | 7.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |