C62H66O10 — CID 146032483
(2S,4S,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxane (PubChem CID 146032483) has the molecular formula C62H66O10 and a molecular weight of 971.20 g/mol. Its IUPAC name is (2S,4S,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxane.
| Compound Name | (2S,4S,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxane |
|---|---|
| PubChem CID | 146032483 |
| Molecular Formula | C62H66O10 |
| Molecular Weight | 971.20 g/mol |
| Exact Mass | 970.47 |
| IUPAC Name | (2S,4S,5S)-2-methyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,4S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxane |
| SMILES | C[C@@H]1OC(CO[C@@H]2OC(COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C62H66O10/c1-46-56(64-38-48-25-11-3-12-26-48)59(67-41-51-31-17-6-18-32-51)58(66-40-50-29-15-5-16-30-50)55(71-46)45-70-62-61(69-43-53-35-21-8-22-36-53)60(68-42-52-33-19-7-20-34-52)57(65-39-49-27-13-4-14-28-49)54(72-62)44-63-37-47-23-9-2-10-24-47/h2-36,46,54-62H,37-45H2,1H3/t46-,54?,55?,56?,57-,58-,59-,60-,61?,62+/m0/s1 |
| InChIKey | KIORMKIEJLRSLS-YHLPVGSGSA-N |
| XLogP | 11.24 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.20 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |