C54H58O10 — CID 100914116
(2S,3R,4S,5R,6R)-2-[[(2R,3R,4R,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 100914116) has the molecular formula C54H58O10 and a molecular weight of 867.05 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[[(2R,3R,4R,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-[[(2R,3R,4R,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 100914116 |
| Molecular Formula | C54H58O10 |
| Molecular Weight | 867.05 g/mol |
| Exact Mass | 866.40 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[[(2R,3R,4R,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CO[C@@H]1O[C@H](CO[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C54H58O10/c1-55-53-51(60-36-44-28-16-6-17-29-44)49(58-34-42-24-12-4-13-25-42)47(63-53)39-62-54-52(61-37-45-30-18-7-19-31-45)50(59-35-43-26-14-5-15-27-43)48(57-33-41-22-10-3-11-23-41)46(64-54)38-56-32-40-20-8-2-9-21-40/h2-31,46-54H,32-39H2,1H3/t46-,47-,48-,49-,50+,51-,52-,53-,54+/m1/s1 |
| InChIKey | MJRSVOABHKZDCF-UBUSMZKFSA-N |
| XLogP | 9.24 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.05 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |