C49H56O11 — CID 102027655
(2S,3S,4S,5R,6R)-2-methoxy-4-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 102027655) has the molecular formula C49H56O11 and a molecular weight of 820.98 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-methoxy-4-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2S,3S,4S,5R,6R)-2-methoxy-4-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 102027655 |
| Molecular Formula | C49H56O11 |
| Molecular Weight | 820.98 g/mol |
| Exact Mass | 820.38 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-methoxy-4-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OC[C@H]2O[C@H](OC)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C49H56O11/c1-51-48-42(50)45(43(54-29-36-20-10-4-11-21-36)40(59-48)33-53-28-35-18-8-3-9-19-35)58-34-41-44(55-30-37-22-12-5-13-23-37)46(56-31-38-24-14-6-15-25-38)47(49(52-2)60-41)57-32-39-26-16-7-17-27-39/h3-27,40-50H,28-34H2,1-2H3/t40-,41-,42+,43-,44-,45+,46+,47-,48+,49+/m1/s1 |
| InChIKey | OZLPEJXOUWKUSA-QAXNFRNDSA-N |
| XLogP | 7.03 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.98 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |