C48H54O11 — CID 101071806
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxy-5-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-3-ol (PubChem CID 101071806) has the molecular formula C48H54O11 and a molecular weight of 806.95 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxy-5-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-3-ol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxy-5-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-3-ol |
|---|---|
| PubChem CID | 101071806 |
| Molecular Formula | C48H54O11 |
| Molecular Weight | 806.95 g/mol |
| Exact Mass | 806.37 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxy-4-phenylmethoxy-5-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-3-ol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](OCc2ccccc2)[C@H]1O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H54O11/c1-51-47-46(43(41(50)39(27-49)57-47)54-30-36-21-11-4-12-22-36)59-48-45(56-32-38-25-15-6-16-26-38)44(55-31-37-23-13-5-14-24-37)42(53-29-35-19-9-3-10-20-35)40(58-48)33-52-28-34-17-7-2-8-18-34/h2-26,39-50H,27-33H2,1H3/t39-,40-,41+,42-,43+,44+,45-,46-,47-,48-/m1/s1 |
| InChIKey | QEAPTZHEGSSYHA-JSVAWVBPSA-N |
| XLogP | 6.38 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.95 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |