C40H46O10 — CID 46895944
[(2R,3R,4S,5S)-5-[(2S,3S,4R,5R)-2-methoxy-5-[(4-methoxyphenyl)methoxymethyl]-4-phenylmethoxyoxolan-3-yl]oxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol (PubChem CID 46895944) has the molecular formula C40H46O10 and a molecular weight of 686.80 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-5-[(2S,3S,4R,5R)-2-methoxy-5-[(4-methoxyphenyl)methoxymethyl]-4-phenylmethoxyoxolan-3-yl]oxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5S)-5-[(2S,3S,4R,5R)-2-methoxy-5-[(4-methoxyphenyl)methoxymethyl]-4-phenylmethoxyoxolan-3-yl]oxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 46895944 |
| Molecular Formula | C40H46O10 |
| Molecular Weight | 686.80 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | [(2R,3R,4S,5S)-5-[(2S,3S,4R,5R)-2-methoxy-5-[(4-methoxyphenyl)methoxymethyl]-4-phenylmethoxyoxolan-3-yl]oxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
| SMILES | COc1ccc(COC[C@H]2O[C@H](OC)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](OCc4ccccc4)[C@@H]3OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C40H46O10/c1-42-32-20-18-31(19-21-32)23-44-27-34-36(46-25-29-14-8-4-9-15-29)38(39(43-2)49-34)50-40-37(47-26-30-16-10-5-11-17-30)35(33(22-41)48-40)45-24-28-12-6-3-7-13-28/h3-21,33-41H,22-27H2,1-2H3/t33-,34-,35-,36-,37+,38+,39+,40+/m1/s1 |
| InChIKey | DZYJGFQAFQJNGJ-HKAQGKEBSA-N |
| XLogP | 5.44 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |