C35H38O7 — CID 11365130
[(2R,3R,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 11365130) has the molecular formula C35H38O7 and a molecular weight of 570.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 11365130 |
| Molecular Formula | C35H38O7 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | COc1ccc(CO[C@H]2[C@@H](OCc3ccccc3)O[C@H](CO)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H38O7/c1-37-30-19-17-29(18-20-30)24-40-34-33(39-23-27-13-7-3-8-14-27)32(38-22-26-11-5-2-6-12-26)31(21-36)42-35(34)41-25-28-15-9-4-10-16-28/h2-20,31-36H,21-25H2,1H3/t31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | CDQKQHADLOYLFQ-KJQSSVQNSA-N |
| XLogP | 5.69 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |