C55H60O11 — CID 163470543
[(3R,6S)-6-[[(3R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 163470543) has the molecular formula C55H60O11 and a molecular weight of 897.07 g/mol. Its IUPAC name is [(3R,6S)-6-[[(3R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(3R,6S)-6-[[(3R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 163470543 |
| Molecular Formula | C55H60O11 |
| Molecular Weight | 897.07 g/mol |
| Exact Mass | 896.41 |
| IUPAC Name | [(3R,6S)-6-[[(3R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CO[C@H]1OC(CO[C@H]2OC(CO)[C@@H](OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C55H60O11/c1-57-54-52(62-37-44-28-16-6-17-29-44)51(61-36-43-26-14-5-15-27-43)49(59-34-41-22-10-3-11-23-41)47(66-54)39-64-55-53(63-38-45-30-18-7-19-31-45)50(60-35-42-24-12-4-13-25-42)48(46(32-56)65-55)58-33-40-20-8-2-9-21-40/h2-31,46-56H,32-39H2,1H3/t46?,47?,48-,49-,50?,51?,52?,53?,54+,55+/m1/s1 |
| InChIKey | BWEYUPJLUVTHLY-AKQRBLQUSA-N |
| XLogP | 8.60 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.07 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |