C29H34O6 — CID 67155731
(2S,3S,4S,5R,6R)-2-methoxy-6-(methoxymethyl)-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 67155731) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-methoxy-6-(methoxymethyl)-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2S,3S,4S,5R,6R)-2-methoxy-6-(methoxymethyl)-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 67155731 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-methoxy-6-(methoxymethyl)-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | COC[C@H]1O[C@H](OC)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H34O6/c1-30-21-25-26(32-18-22-12-6-3-7-13-22)27(33-19-23-14-8-4-9-15-23)28(29(31-2)35-25)34-20-24-16-10-5-11-17-24/h3-17,25-29H,18-21H2,1-2H3/t25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | LOMYNLNNGFNSAK-PNHLWVRCSA-N |
| XLogP | 4.76 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |