C17H26O6 — CID 70289541
(2S,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)-3-phenylmethoxyoxane (PubChem CID 70289541) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)-3-phenylmethoxyoxane.
| Compound Name | (2S,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 70289541 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)-3-phenylmethoxyoxane |
| SMILES | COC[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C17H26O6/c1-18-11-13-14(19-2)15(20-3)16(17(21-4)23-13)22-10-12-8-6-5-7-9-12/h5-9,13-17H,10-11H2,1-4H3/t13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | SDAIUSNELACJDQ-UUAJXVIYSA-N |
| XLogP | 1.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |