C16H24O5 — CID 11500331
(2R,3R,4R,5S,6S)-2,4,5-trimethoxy-6-methyl-3-phenylmethoxyoxane (PubChem CID 11500331) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-2,4,5-trimethoxy-6-methyl-3-phenylmethoxyoxane.
| Compound Name | (2R,3R,4R,5S,6S)-2,4,5-trimethoxy-6-methyl-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 11500331 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2R,3R,4R,5S,6S)-2,4,5-trimethoxy-6-methyl-3-phenylmethoxyoxane |
| SMILES | CO[C@@H]1O[C@@H](C)[C@H](OC)[C@@H](OC)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C16H24O5/c1-11-13(17-2)14(18-3)15(16(19-4)21-11)20-10-12-8-6-5-7-9-12/h5-9,11,13-16H,10H2,1-4H3/t11-,13-,14+,15+,16+/m0/s1 |
| InChIKey | FONUJMMONWWWDJ-RBRCJPGISA-N |
| XLogP | 1.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |